C22H30N3O+ — CID 4228452
4-benzhydryl-N,N-diethylpiperazin-4-ium-1-carboxamide (PubChem CID 4228452) has the molecular formula C22H30N3O+ and a molecular weight of 352.50 g/mol. Its IUPAC name is 4-benzhydryl-N,N-diethylpiperazin-4-ium-1-carboxamide.
| Compound Name | 4-benzhydryl-N,N-diethylpiperazin-4-ium-1-carboxamide |
|---|---|
| PubChem CID | 4228452 |
| Molecular Formula | C22H30N3O+ |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 4-benzhydryl-N,N-diethylpiperazin-4-ium-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1CC[NH+](C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H29N3O/c1-3-23(4-2)22(26)25-17-15-24(16-18-25)21(19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-14,21H,3-4,15-18H2,1-2H3/p+1 |
| InChIKey | VFMPQJVAYSPQCF-UHFFFAOYSA-O |
| XLogP | 2.44 |
| TPSA | 27.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |