C27H30N3O2+ — CID 7472809
N-[2-(4-benzhydrylpiperazin-4-ium-1-yl)-2-oxoethyl]-2-phenylacetamide (PubChem CID 7472809) has the molecular formula C27H30N3O2+ and a molecular weight of 428.56 g/mol. Its IUPAC name is N-[2-(4-benzhydrylpiperazin-4-ium-1-yl)-2-oxoethyl]-2-phenylacetamide.
| Compound Name | N-[2-(4-benzhydrylpiperazin-4-ium-1-yl)-2-oxoethyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 7472809 |
| Molecular Formula | C27H30N3O2+ |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | N-[2-(4-benzhydrylpiperazin-4-ium-1-yl)-2-oxoethyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NCC(=O)N1CC[NH+](C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C27H29N3O2/c31-25(20-22-10-4-1-5-11-22)28-21-26(32)29-16-18-30(19-17-29)27(23-12-6-2-7-13-23)24-14-8-3-9-15-24/h1-15,27H,16-21H2,(H,28,31)/p+1 |
| InChIKey | GIVFLDVGSJVCRA-UHFFFAOYSA-O |
| XLogP | 1.86 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |