C17H22N2O4 — CID 51166527
methyl 1-[2-[(2-phenylacetyl)amino]acetyl]piperidine-4-carboxylate (PubChem CID 51166527) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is methyl 1-[2-[(2-phenylacetyl)amino]acetyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[2-[(2-phenylacetyl)amino]acetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 51166527 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | methyl 1-[2-[(2-phenylacetyl)amino]acetyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)CNC(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C17H22N2O4/c1-23-17(22)14-7-9-19(10-8-14)16(21)12-18-15(20)11-13-5-3-2-4-6-13/h2-6,14H,7-12H2,1H3,(H,18,20) |
| InChIKey | GYRXNKDPZDPGNN-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |