C18H28ClN3O2 — CID 119644723
N-[2-[4-(ethylaminomethyl)piperidin-1-yl]-2-oxoethyl]-2-phenylacetamide;hydrochloride (PubChem CID 119644723) has the molecular formula C18H28ClN3O2 and a molecular weight of 353.89 g/mol. Its IUPAC name is N-[2-[4-(ethylaminomethyl)piperidin-1-yl]-2-oxoethyl]-2-phenylacetamide;hydrochloride.
| Compound Name | N-[2-[4-(ethylaminomethyl)piperidin-1-yl]-2-oxoethyl]-2-phenylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119644723 |
| Molecular Formula | C18H28ClN3O2 |
| Molecular Weight | 353.89 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | N-[2-[4-(ethylaminomethyl)piperidin-1-yl]-2-oxoethyl]-2-phenylacetamide;hydrochloride |
| SMILES | CCNCC1CCN(C(=O)CNC(=O)Cc2ccccc2)CC1.Cl |
| InChI | InChI=1S/C18H27N3O2.ClH/c1-2-19-13-16-8-10-21(11-9-16)18(23)14-20-17(22)12-15-6-4-3-5-7-15;/h3-7,16,19H,2,8-14H2,1H3,(H,20,22);1H |
| InChIKey | JARHYHOCIUBONC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.89 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |