C23H31ClN2O3 — CID 119644698
1-[4-(ethylaminomethyl)piperidin-1-yl]-2-(4-phenylmethoxyphenoxy)ethanone;hydrochloride (PubChem CID 119644698) has the molecular formula C23H31ClN2O3 and a molecular weight of 418.97 g/mol. Its IUPAC name is 1-[4-(ethylaminomethyl)piperidin-1-yl]-2-(4-phenylmethoxyphenoxy)ethanone;hydrochloride.
| Compound Name | 1-[4-(ethylaminomethyl)piperidin-1-yl]-2-(4-phenylmethoxyphenoxy)ethanone;hydrochloride |
|---|---|
| PubChem CID | 119644698 |
| Molecular Formula | C23H31ClN2O3 |
| Molecular Weight | 418.97 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 1-[4-(ethylaminomethyl)piperidin-1-yl]-2-(4-phenylmethoxyphenoxy)ethanone;hydrochloride |
| SMILES | CCNCC1CCN(C(=O)COc2ccc(OCc3ccccc3)cc2)CC1.Cl |
| InChI | InChI=1S/C23H30N2O3.ClH/c1-2-24-16-19-12-14-25(15-13-19)23(26)18-28-22-10-8-21(9-11-22)27-17-20-6-4-3-5-7-20;/h3-11,19,24H,2,12-18H2,1H3;1H |
| InChIKey | UYTNTOIDMHSEFA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.97 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |