C21H24Cl2N2O2 — CID 138623889
1-[4-[(benzylamino)methyl]piperidin-1-yl]-2-(3,4-dichlorophenoxy)ethanone (PubChem CID 138623889) has the molecular formula C21H24Cl2N2O2 and a molecular weight of 407.34 g/mol. Its IUPAC name is 1-[4-[(benzylamino)methyl]piperidin-1-yl]-2-(3,4-dichlorophenoxy)ethanone.
| Compound Name | 1-[4-[(benzylamino)methyl]piperidin-1-yl]-2-(3,4-dichlorophenoxy)ethanone |
|---|---|
| PubChem CID | 138623889 |
| Molecular Formula | C21H24Cl2N2O2 |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 1-[4-[(benzylamino)methyl]piperidin-1-yl]-2-(3,4-dichlorophenoxy)ethanone |
| SMILES | O=C(COc1ccc(Cl)c(Cl)c1)N1CCC(CNCc2ccccc2)CC1 |
| InChI | InChI=1S/C21H24Cl2N2O2/c22-19-7-6-18(12-20(19)23)27-15-21(26)25-10-8-17(9-11-25)14-24-13-16-4-2-1-3-5-16/h1-7,12,17,24H,8-11,13-15H2 |
| InChIKey | CQYYSYSWPLXGKN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |