C16H21Cl2NO4S — CID 176667713
2-(3,4-dichlorophenoxy)-1-(4-propan-2-ylsulfonylpiperidin-1-yl)ethanone (PubChem CID 176667713) has the molecular formula C16H21Cl2NO4S and a molecular weight of 394.32 g/mol. Its IUPAC name is 2-(3,4-dichlorophenoxy)-1-(4-propan-2-ylsulfonylpiperidin-1-yl)ethanone.
| Compound Name | 2-(3,4-dichlorophenoxy)-1-(4-propan-2-ylsulfonylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 176667713 |
| Molecular Formula | C16H21Cl2NO4S |
| Molecular Weight | 394.32 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 2-(3,4-dichlorophenoxy)-1-(4-propan-2-ylsulfonylpiperidin-1-yl)ethanone |
| SMILES | CC(C)S(=O)(=O)C1CCN(C(=O)COc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C16H21Cl2NO4S/c1-11(2)24(21,22)13-5-7-19(8-6-13)16(20)10-23-12-3-4-14(17)15(18)9-12/h3-4,9,11,13H,5-8,10H2,1-2H3 |
| InChIKey | GCXWESLCWQQECK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |