C16H22Cl2N2O2 — CID 55598057
2-(3,4-dichlorophenoxy)-1-[4-(2-methylpropyl)piperazin-1-yl]ethanone (PubChem CID 55598057) has the molecular formula C16H22Cl2N2O2 and a molecular weight of 345.27 g/mol. Its IUPAC name is 2-(3,4-dichlorophenoxy)-1-[4-(2-methylpropyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(3,4-dichlorophenoxy)-1-[4-(2-methylpropyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 55598057 |
| Molecular Formula | C16H22Cl2N2O2 |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 2-(3,4-dichlorophenoxy)-1-[4-(2-methylpropyl)piperazin-1-yl]ethanone |
| SMILES | CC(C)CN1CCN(C(=O)COc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C16H22Cl2N2O2/c1-12(2)10-19-5-7-20(8-6-19)16(21)11-22-13-3-4-14(17)15(18)9-13/h3-4,9,12H,5-8,10-11H2,1-2H3 |
| InChIKey | GFWDOEYKRDKNCA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |