C14H17BrN2O5 — CID 51166514
methyl 1-[2-[(5-bromofuran-2-carbonyl)amino]acetyl]piperidine-4-carboxylate (PubChem CID 51166514) has the molecular formula C14H17BrN2O5 and a molecular weight of 373.20 g/mol. Its IUPAC name is methyl 1-[2-[(5-bromofuran-2-carbonyl)amino]acetyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[2-[(5-bromofuran-2-carbonyl)amino]acetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 51166514 |
| Molecular Formula | C14H17BrN2O5 |
| Molecular Weight | 373.20 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | methyl 1-[2-[(5-bromofuran-2-carbonyl)amino]acetyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)CNC(=O)c2ccc(Br)o2)CC1 |
| InChI | InChI=1S/C14H17BrN2O5/c1-21-14(20)9-4-6-17(7-5-9)12(18)8-16-13(19)10-2-3-11(15)22-10/h2-3,9H,4-8H2,1H3,(H,16,19) |
| InChIKey | AQYCNONHBGSVAJ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.20 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |