C20H24BrN3O3 — CID 86791126
N-[2-(4-benzyl-3-ethylpiperazin-1-yl)-2-oxoethyl]-5-bromofuran-2-carboxamide (PubChem CID 86791126) has the molecular formula C20H24BrN3O3 and a molecular weight of 434.33 g/mol. Its IUPAC name is N-[2-(4-benzyl-3-ethylpiperazin-1-yl)-2-oxoethyl]-5-bromofuran-2-carboxamide.
| Compound Name | N-[2-(4-benzyl-3-ethylpiperazin-1-yl)-2-oxoethyl]-5-bromofuran-2-carboxamide |
|---|---|
| PubChem CID | 86791126 |
| Molecular Formula | C20H24BrN3O3 |
| Molecular Weight | 434.33 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | N-[2-(4-benzyl-3-ethylpiperazin-1-yl)-2-oxoethyl]-5-bromofuran-2-carboxamide |
| SMILES | CCC1CN(C(=O)CNC(=O)c2ccc(Br)o2)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C20H24BrN3O3/c1-2-16-14-24(11-10-23(16)13-15-6-4-3-5-7-15)19(25)12-22-20(26)17-8-9-18(21)27-17/h3-9,16H,2,10-14H2,1H3,(H,22,26) |
| InChIKey | AJNYFPKKAZQJMR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |