C17H17BrFN3O3 — CID 7494653
5-bromo-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl]furan-2-carboxamide (PubChem CID 7494653) has the molecular formula C17H17BrFN3O3 and a molecular weight of 410.24 g/mol. Its IUPAC name is 5-bromo-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 7494653 |
| Molecular Formula | C17H17BrFN3O3 |
| Molecular Weight | 410.24 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | 5-bromo-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl]furan-2-carboxamide |
| SMILES | O=C(NCC(=O)N1CCN(c2ccc(F)cc2)CC1)c1ccc(Br)o1 |
| InChI | InChI=1S/C17H17BrFN3O3/c18-15-6-5-14(25-15)17(24)20-11-16(23)22-9-7-21(8-10-22)13-3-1-12(19)2-4-13/h1-6H,7-11H2,(H,20,24) |
| InChIKey | OEZKYWQESGULLP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |