C20H19F4N3O2 — CID 9081766
N-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-4-(trifluoromethyl)benzamide (PubChem CID 9081766) has the molecular formula C20H19F4N3O2 and a molecular weight of 409.38 g/mol. Its IUPAC name is N-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 9081766 |
| Molecular Formula | C20H19F4N3O2 |
| Molecular Weight | 409.38 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | N-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(NCC(=O)N1CCN(c2ccc(F)cc2)CC1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H19F4N3O2/c21-16-5-7-17(8-6-16)26-9-11-27(12-10-26)18(28)13-25-19(29)14-1-3-15(4-2-14)20(22,23)24/h1-8H,9-13H2,(H,25,29) |
| InChIKey | LWEAKRGNFKVSDA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |