C15H19ClF3N3O2 — CID 119376008
N-[2-(4-aminopiperidin-1-yl)-2-oxoethyl]-4-(trifluoromethyl)benzamide;hydrochloride (PubChem CID 119376008) has the molecular formula C15H19ClF3N3O2 and a molecular weight of 365.78 g/mol. Its IUPAC name is N-[2-(4-aminopiperidin-1-yl)-2-oxoethyl]-4-(trifluoromethyl)benzamide;hydrochloride.
| Compound Name | N-[2-(4-aminopiperidin-1-yl)-2-oxoethyl]-4-(trifluoromethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119376008 |
| Molecular Formula | C15H19ClF3N3O2 |
| Molecular Weight | 365.78 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | N-[2-(4-aminopiperidin-1-yl)-2-oxoethyl]-4-(trifluoromethyl)benzamide;hydrochloride |
| SMILES | Cl.NC1CCN(C(=O)CNC(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C15H18F3N3O2.ClH/c16-15(17,18)11-3-1-10(2-4-11)14(23)20-9-13(22)21-7-5-12(19)6-8-21;/h1-4,12H,5-9,19H2,(H,20,23);1H |
| InChIKey | QLHJIAOEQIILIC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.78 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |