C14H17Cl2N3O2 — CID 119373866
N-[2-(4-aminopiperidin-1-yl)-2-oxoethyl]-3,4-dichlorobenzamide (PubChem CID 119373866) has the molecular formula C14H17Cl2N3O2 and a molecular weight of 330.22 g/mol. Its IUPAC name is N-[2-(4-aminopiperidin-1-yl)-2-oxoethyl]-3,4-dichlorobenzamide.
| Compound Name | N-[2-(4-aminopiperidin-1-yl)-2-oxoethyl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 119373866 |
| Molecular Formula | C14H17Cl2N3O2 |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | N-[2-(4-aminopiperidin-1-yl)-2-oxoethyl]-3,4-dichlorobenzamide |
| SMILES | NC1CCN(C(=O)CNC(=O)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C14H17Cl2N3O2/c15-11-2-1-9(7-12(11)16)14(21)18-8-13(20)19-5-3-10(17)4-6-19/h1-2,7,10H,3-6,8,17H2,(H,18,21) |
| InChIKey | CKYBWAZFOLCHPB-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |