About N-[2-[3-(4-acetylpiperazin-1-yl)pyrrolidin-1-yl]-2-oxoethyl]-3,4-dichlorobenzamide
N-[2-[3-(4-acetylpiperazin-1-yl)pyrrolidin-1-yl]-2-oxoethyl]-3,4-dichlorobenzamide (PubChem CID 59764623) has the molecular formula C19H24Cl2N4O3
and a molecular weight of 427.33 g/mol. Its IUPAC name is N-[2-[3-(4-acetylpiperazin-1-yl)pyrrolidin-1-yl]-2-oxoethyl]-3,4-dichlorobenzamide.
Molecular Properties
| Compound Name | N-[2-[3-(4-acetylpiperazin-1-yl)pyrrolidin-1-yl]-2-oxoethyl]-3,4-dichlorobenzamide |
| PubChem CID | 59764623 |
| Molecular Formula | C19H24Cl2N4O3 |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | N-[2-[3-(4-acetylpiperazin-1-yl)pyrrolidin-1-yl]-2-oxoethyl]-3,4-dichlorobenzamide |
| SMILES | CC(=O)N1CCN(C2CCN(C(=O)CNC(=O)c3ccc(Cl)c(Cl)c3)C2)CC1 |
| InChI | InChI=1S/C19H24Cl2N4O3/c1-13(26)23-6-8-24(9-7-23)15-4-5-25(12-15)18(27)11-22-19(28)14-2-3-16(20)17(21)10-14/h2-3,10,15H,4-9,11-12H2,1H3,(H,22,28) |
| InChIKey | OZBZTPKUNUVGTB-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-[3-(4-acetylpiperazin-1-yl)pyrrolidin-1-yl]-2-oxoethyl]-3,4-dichlorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[3-(4-acetylpiperazin-1-yl)pyrrolidin-1-yl]-2-oxoethyl]-3,4-dichlorobenzamide?
The IUPAC name of N-[2-[3-(4-acetylpiperazin-1-yl)pyrrolidin-1-yl]-2-oxoethyl]-3,4-dichlorobenzamide (CID 59764623) is N-[2-[3-(4-acetylpiperazin-1-yl)pyrrolidin-1-yl]-2-oxoethyl]-3,4-dichlorobenzamide.
What is the SMILES notation for N-[2-[3-(4-acetylpiperazin-1-yl)pyrrolidin-1-yl]-2-oxoethyl]-3,4-dichlorobenzamide?
The canonical SMILES for N-[2-[3-(4-acetylpiperazin-1-yl)pyrrolidin-1-yl]-2-oxoethyl]-3,4-dichlorobenzamide is CC(=O)N1CCN(C2CCN(C(=O)CNC(=O)c3ccc(Cl)c(Cl)c3)C2)CC1.
What is the InChIKey of N-[2-[3-(4-acetylpiperazin-1-yl)pyrrolidin-1-yl]-2-oxoethyl]-3,4-dichlorobenzamide?
The InChIKey is OZBZTPKUNUVGTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24Cl2N4O3/c1-13(26)23-6-8-24(9-7-23)15-4-5-25(12-15)18(27)11-22-19(28)14-2-3-16(20)17(21)10-14/h2-3,10,15H,4-9,11-12H2,1H3,(H,22,28).
What are the key properties of N-[2-[3-(4-acetylpiperazin-1-yl)pyrrolidin-1-yl]-2-oxoethyl]-3,4-dichlorobenzamide?
N-[2-[3-(4-acetylpiperazin-1-yl)pyrrolidin-1-yl]-2-oxoethyl]-3,4-dichlorobenzamide has a molecular weight of 427.33 g/mol, XLogP of 1.49, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[3-(4-acetylpiperazin-1-yl)pyrrolidin-1-yl]-2-oxoethyl]-3,4-dichlorobenzamide is sourced from PubChem (CID 59764623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).