C19H19F2N3O2 — CID 26590726
4-fluoro-N-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]benzamide (PubChem CID 26590726) has the molecular formula C19H19F2N3O2 and a molecular weight of 359.38 g/mol. Its IUPAC name is 4-fluoro-N-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]benzamide.
| Compound Name | 4-fluoro-N-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 26590726 |
| Molecular Formula | C19H19F2N3O2 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 4-fluoro-N-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]benzamide |
| SMILES | O=C(NCC(=O)N1CCN(c2ccccc2F)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H19F2N3O2/c20-15-7-5-14(6-8-15)19(26)22-13-18(25)24-11-9-23(10-12-24)17-4-2-1-3-16(17)21/h1-8H,9-13H2,(H,22,26) |
| InChIKey | MVEGJWSNSLFNPX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |