C24H30FN3O3 — CID 87042207
4-butoxy-N-[2-[4-(4-fluorophenyl)-1,4-diazepan-1-yl]-2-oxoethyl]benzamide (PubChem CID 87042207) has the molecular formula C24H30FN3O3 and a molecular weight of 427.52 g/mol. Its IUPAC name is 4-butoxy-N-[2-[4-(4-fluorophenyl)-1,4-diazepan-1-yl]-2-oxoethyl]benzamide.
| Compound Name | 4-butoxy-N-[2-[4-(4-fluorophenyl)-1,4-diazepan-1-yl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 87042207 |
| Molecular Formula | C24H30FN3O3 |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | 4-butoxy-N-[2-[4-(4-fluorophenyl)-1,4-diazepan-1-yl]-2-oxoethyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NCC(=O)N2CCCN(c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C24H30FN3O3/c1-2-3-17-31-22-11-5-19(6-12-22)24(30)26-18-23(29)28-14-4-13-27(15-16-28)21-9-7-20(25)8-10-21/h5-12H,2-4,13-18H2,1H3,(H,26,30) |
| InChIKey | BHRLKIBYHOEAKP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|