C25H31N3O5 — CID 38321399
4-butoxy-N-[2-[4-(4-methoxybenzoyl)piperazin-1-yl]-2-oxoethyl]benzamide (PubChem CID 38321399) has the molecular formula C25H31N3O5 and a molecular weight of 453.54 g/mol. Its IUPAC name is 4-butoxy-N-[2-[4-(4-methoxybenzoyl)piperazin-1-yl]-2-oxoethyl]benzamide.
| Compound Name | 4-butoxy-N-[2-[4-(4-methoxybenzoyl)piperazin-1-yl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 38321399 |
| Molecular Formula | C25H31N3O5 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 4-butoxy-N-[2-[4-(4-methoxybenzoyl)piperazin-1-yl]-2-oxoethyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NCC(=O)N2CCN(C(=O)c3ccc(OC)cc3)CC2)cc1 |
| InChI | InChI=1S/C25H31N3O5/c1-3-4-17-33-22-11-5-19(6-12-22)24(30)26-18-23(29)27-13-15-28(16-14-27)25(31)20-7-9-21(32-2)10-8-20/h5-12H,3-4,13-18H2,1-2H3,(H,26,30) |
| InChIKey | QYTNUFNJMYROHE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|