C16H24N3O3+ — CID 6988242
N-[2-(4-ethylpiperazin-4-ium-1-yl)-2-oxoethyl]-4-methoxybenzamide (PubChem CID 6988242) has the molecular formula C16H24N3O3+ and a molecular weight of 306.39 g/mol. Its IUPAC name is N-[2-(4-ethylpiperazin-4-ium-1-yl)-2-oxoethyl]-4-methoxybenzamide.
| Compound Name | N-[2-(4-ethylpiperazin-4-ium-1-yl)-2-oxoethyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 6988242 |
| Molecular Formula | C16H24N3O3+ |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | N-[2-(4-ethylpiperazin-4-ium-1-yl)-2-oxoethyl]-4-methoxybenzamide |
| SMILES | CC[NH+]1CCN(C(=O)CNC(=O)c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C16H23N3O3/c1-3-18-8-10-19(11-9-18)15(20)12-17-16(21)13-4-6-14(22-2)7-5-13/h4-7H,3,8-12H2,1-2H3,(H,17,21)/p+1 |
| InChIKey | PZCRLHCPNYKRHM-UHFFFAOYSA-O |
| XLogP | -0.83 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |