C23H29N3O3 — CID 122020879
4-[[(4-benzyl-3-propylpiperazine-1-carbonyl)amino]methyl]benzoic acid (PubChem CID 122020879) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is 4-[[(4-benzyl-3-propylpiperazine-1-carbonyl)amino]methyl]benzoic acid.
| Compound Name | 4-[[(4-benzyl-3-propylpiperazine-1-carbonyl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122020879 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 4-[[(4-benzyl-3-propylpiperazine-1-carbonyl)amino]methyl]benzoic acid |
| SMILES | CCCC1CN(C(=O)NCc2ccc(C(=O)O)cc2)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C23H29N3O3/c1-2-6-21-17-26(14-13-25(21)16-19-7-4-3-5-8-19)23(29)24-15-18-9-11-20(12-10-18)22(27)28/h3-5,7-12,21H,2,6,13-17H2,1H3,(H,24,29)(H,27,28) |
| InChIKey | IYCYKVBHVQYPQG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |