C15H21N3O5S — CID 122020881
4-[[[(3S)-3-methyl-4-methylsulfonylpiperazine-1-carbonyl]amino]methyl]benzoic acid (PubChem CID 122020881) has the molecular formula C15H21N3O5S and a molecular weight of 355.42 g/mol. Its IUPAC name is 4-[[[(3S)-3-methyl-4-methylsulfonylpiperazine-1-carbonyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[(3S)-3-methyl-4-methylsulfonylpiperazine-1-carbonyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122020881 |
| Molecular Formula | C15H21N3O5S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 4-[[[(3S)-3-methyl-4-methylsulfonylpiperazine-1-carbonyl]amino]methyl]benzoic acid |
| SMILES | C[C@H]1CN(C(=O)NCc2ccc(C(=O)O)cc2)CCN1S(C)(=O)=O |
| InChI | InChI=1S/C15H21N3O5S/c1-11-10-17(7-8-18(11)24(2,22)23)15(21)16-9-12-3-5-13(6-4-12)14(19)20/h3-6,11H,7-10H2,1-2H3,(H,16,21)(H,19,20)/t11-/m0/s1 |
| InChIKey | IJNGTMQBHSOZCP-NSHDSACASA-N |
| XLogP | 0.56 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |