C12H16N2O6S — CID 120552708
5-[(3S)-3-methyl-4-methylsulfonylpiperazine-1-carbonyl]furan-2-carboxylic acid (PubChem CID 120552708) has the molecular formula C12H16N2O6S and a molecular weight of 316.34 g/mol. Its IUPAC name is 5-[(3S)-3-methyl-4-methylsulfonylpiperazine-1-carbonyl]furan-2-carboxylic acid.
| Compound Name | 5-[(3S)-3-methyl-4-methylsulfonylpiperazine-1-carbonyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 120552708 |
| Molecular Formula | C12H16N2O6S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 5-[(3S)-3-methyl-4-methylsulfonylpiperazine-1-carbonyl]furan-2-carboxylic acid |
| SMILES | C[C@H]1CN(C(=O)c2ccc(C(=O)O)o2)CCN1S(C)(=O)=O |
| InChI | InChI=1S/C12H16N2O6S/c1-8-7-13(5-6-14(8)21(2,18)19)11(15)9-3-4-10(20-9)12(16)17/h3-4,8H,5-7H2,1-2H3,(H,16,17)/t8-/m0/s1 |
| InChIKey | IIOWWJYXUSGKQE-QMMMGPOBSA-N |
| XLogP | 0.08 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |