C9H20ClN3O3S — CID 120874133
(2R)-2-amino-1-[(3S)-3-methyl-4-methylsulfonylpiperazin-1-yl]propan-1-one;hydrochloride (PubChem CID 120874133) has the molecular formula C9H20ClN3O3S and a molecular weight of 285.80 g/mol. Its IUPAC name is (2R)-2-amino-1-[(3S)-3-methyl-4-methylsulfonylpiperazin-1-yl]propan-1-one;hydrochloride.
| Compound Name | (2R)-2-amino-1-[(3S)-3-methyl-4-methylsulfonylpiperazin-1-yl]propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120874133 |
| Molecular Formula | C9H20ClN3O3S |
| Molecular Weight | 285.80 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | (2R)-2-amino-1-[(3S)-3-methyl-4-methylsulfonylpiperazin-1-yl]propan-1-one;hydrochloride |
| SMILES | C[C@@H](N)C(=O)N1CCN(S(C)(=O)=O)[C@@H](C)C1.Cl |
| InChI | InChI=1S/C9H19N3O3S.ClH/c1-7-6-11(9(13)8(2)10)4-5-12(7)16(3,14)15;/h7-8H,4-6,10H2,1-3H3;1H/t7-,8+;/m0./s1 |
| InChIKey | LTKJTYXVSRXLET-KZYPOYLOSA-N |
| XLogP | -0.75 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.80 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |