C17H25N3O3 — CID 122017912
3-[(4-benzyl-3-ethylpiperazine-1-carbonyl)amino]propanoic acid (PubChem CID 122017912) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is 3-[(4-benzyl-3-ethylpiperazine-1-carbonyl)amino]propanoic acid.
| Compound Name | 3-[(4-benzyl-3-ethylpiperazine-1-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 122017912 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 3-[(4-benzyl-3-ethylpiperazine-1-carbonyl)amino]propanoic acid |
| SMILES | CCC1CN(C(=O)NCCC(=O)O)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C17H25N3O3/c1-2-15-13-20(17(23)18-9-8-16(21)22)11-10-19(15)12-14-6-4-3-5-7-14/h3-7,15H,2,8-13H2,1H3,(H,18,23)(H,21,22) |
| InChIKey | DMWHXYYPPPVCIZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |