C13H16BrNO4 — CID 112690033
methyl 4-[(5-bromofuran-2-carbonyl)amino]cyclohexane-1-carboxylate (PubChem CID 112690033) has the molecular formula C13H16BrNO4 and a molecular weight of 330.18 g/mol. Its IUPAC name is methyl 4-[(5-bromofuran-2-carbonyl)amino]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[(5-bromofuran-2-carbonyl)amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 112690033 |
| Molecular Formula | C13H16BrNO4 |
| Molecular Weight | 330.18 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | methyl 4-[(5-bromofuran-2-carbonyl)amino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(NC(=O)c2ccc(Br)o2)CC1 |
| InChI | InChI=1S/C13H16BrNO4/c1-18-13(17)8-2-4-9(5-3-8)15-12(16)10-6-7-11(14)19-10/h6-9H,2-5H2,1H3,(H,15,16) |
| InChIKey | DABCVJGMCNJPIY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.18 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |