C15H22BrNO2 — CID 103966929
5-bromo-N-(3,3,5,5-tetramethylcyclohexyl)furan-2-carboxamide (PubChem CID 103966929) has the molecular formula C15H22BrNO2 and a molecular weight of 328.25 g/mol. Its IUPAC name is 5-bromo-N-(3,3,5,5-tetramethylcyclohexyl)furan-2-carboxamide.
| Compound Name | 5-bromo-N-(3,3,5,5-tetramethylcyclohexyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 103966929 |
| Molecular Formula | C15H22BrNO2 |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 5-bromo-N-(3,3,5,5-tetramethylcyclohexyl)furan-2-carboxamide |
| SMILES | CC1(C)CC(NC(=O)c2ccc(Br)o2)CC(C)(C)C1 |
| InChI | InChI=1S/C15H22BrNO2/c1-14(2)7-10(8-15(3,4)9-14)17-13(18)11-5-6-12(16)19-11/h5-6,10H,7-9H2,1-4H3,(H,17,18) |
| InChIKey | SAEBYXGNMOKBIV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |