C11H16BrClN2O2 — CID 119474938
N-(4-aminocyclohexyl)-5-bromofuran-2-carboxamide;hydrochloride (PubChem CID 119474938) has the molecular formula C11H16BrClN2O2 and a molecular weight of 323.62 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-5-bromofuran-2-carboxamide;hydrochloride.
| Compound Name | N-(4-aminocyclohexyl)-5-bromofuran-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119474938 |
| Molecular Formula | C11H16BrClN2O2 |
| Molecular Weight | 323.62 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | N-(4-aminocyclohexyl)-5-bromofuran-2-carboxamide;hydrochloride |
| SMILES | Cl.NC1CCC(NC(=O)c2ccc(Br)o2)CC1 |
| InChI | InChI=1S/C11H15BrN2O2.ClH/c12-10-6-5-9(16-10)11(15)14-8-3-1-7(13)2-4-8;/h5-8H,1-4,13H2,(H,14,15);1H |
| InChIKey | FQONRKJMMJOHCQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.62 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |