C11H15BrN2O2 — CID 93452199
N-[(1R,2R)-2-aminocyclohexyl]-5-bromofuran-2-carboxamide (PubChem CID 93452199) has the molecular formula C11H15BrN2O2 and a molecular weight of 287.16 g/mol. Its IUPAC name is N-[(1R,2R)-2-aminocyclohexyl]-5-bromofuran-2-carboxamide.
| Compound Name | N-[(1R,2R)-2-aminocyclohexyl]-5-bromofuran-2-carboxamide |
|---|---|
| PubChem CID | 93452199 |
| Molecular Formula | C11H15BrN2O2 |
| Molecular Weight | 287.16 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | N-[(1R,2R)-2-aminocyclohexyl]-5-bromofuran-2-carboxamide |
| SMILES | N[C@@H]1CCCC[C@H]1NC(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C11H15BrN2O2/c12-10-6-5-9(16-10)11(15)14-8-4-2-1-3-7(8)13/h5-8H,1-4,13H2,(H,14,15)/t7-,8-/m1/s1 |
| InChIKey | XSQRONIJPWDYNC-HTQZYQBOSA-N |
| XLogP | 2.04 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.16 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |