C9H10BrNO4 — CID 130700415
5-bromo-N-(4-hydroxyoxolan-3-yl)furan-2-carboxamide (PubChem CID 130700415) has the molecular formula C9H10BrNO4 and a molecular weight of 276.09 g/mol. Its IUPAC name is 5-bromo-N-(4-hydroxyoxolan-3-yl)furan-2-carboxamide.
| Compound Name | 5-bromo-N-(4-hydroxyoxolan-3-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 130700415 |
| Molecular Formula | C9H10BrNO4 |
| Molecular Weight | 276.09 g/mol |
| Exact Mass | 274.98 |
| IUPAC Name | 5-bromo-N-(4-hydroxyoxolan-3-yl)furan-2-carboxamide |
| SMILES | O=C(NC1COCC1O)c1ccc(Br)o1 |
| InChI | InChI=1S/C9H10BrNO4/c10-8-2-1-7(15-8)9(13)11-5-3-14-4-6(5)12/h1-2,5-6,12H,3-4H2,(H,11,13) |
| InChIKey | HVBSVRLOKMMKDV-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.09 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |