C15H15BrN2O4 — CID 38198333
5-bromo-N-[1-(furan-3-carbonyl)piperidin-4-yl]furan-2-carboxamide (PubChem CID 38198333) has the molecular formula C15H15BrN2O4 and a molecular weight of 367.20 g/mol. Its IUPAC name is 5-bromo-N-[1-(furan-3-carbonyl)piperidin-4-yl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[1-(furan-3-carbonyl)piperidin-4-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 38198333 |
| Molecular Formula | C15H15BrN2O4 |
| Molecular Weight | 367.20 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | 5-bromo-N-[1-(furan-3-carbonyl)piperidin-4-yl]furan-2-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)c2ccoc2)CC1)c1ccc(Br)o1 |
| InChI | InChI=1S/C15H15BrN2O4/c16-13-2-1-12(22-13)14(19)17-11-3-6-18(7-4-11)15(20)10-5-8-21-9-10/h1-2,5,8-9,11H,3-4,6-7H2,(H,17,19) |
| InChIKey | BMBSOPHQVVSSTG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 75.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.20 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |