C18H20BrN3O3 — CID 78874680
1-(3-bromo-4-methylphenyl)-3-[1-(furan-3-carbonyl)piperidin-4-yl]urea (PubChem CID 78874680) has the molecular formula C18H20BrN3O3 and a molecular weight of 406.28 g/mol. Its IUPAC name is 1-(3-bromo-4-methylphenyl)-3-[1-(furan-3-carbonyl)piperidin-4-yl]urea.
| Compound Name | 1-(3-bromo-4-methylphenyl)-3-[1-(furan-3-carbonyl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 78874680 |
| Molecular Formula | C18H20BrN3O3 |
| Molecular Weight | 406.28 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | 1-(3-bromo-4-methylphenyl)-3-[1-(furan-3-carbonyl)piperidin-4-yl]urea |
| SMILES | Cc1ccc(NC(=O)NC2CCN(C(=O)c3ccoc3)CC2)cc1Br |
| InChI | InChI=1S/C18H20BrN3O3/c1-12-2-3-15(10-16(12)19)21-18(24)20-14-4-7-22(8-5-14)17(23)13-6-9-25-11-13/h2-3,6,9-11,14H,4-5,7-8H2,1H3,(H2,20,21,24) |
| InChIKey | ZZABXEYZNDTQJA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.28 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |