C16H16BrN3O3 — CID 108551769
5-bromo-N-[1-(pyridine-2-carbonyl)piperidin-4-yl]furan-2-carboxamide (PubChem CID 108551769) has the molecular formula C16H16BrN3O3 and a molecular weight of 378.23 g/mol. Its IUPAC name is 5-bromo-N-[1-(pyridine-2-carbonyl)piperidin-4-yl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[1-(pyridine-2-carbonyl)piperidin-4-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 108551769 |
| Molecular Formula | C16H16BrN3O3 |
| Molecular Weight | 378.23 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | 5-bromo-N-[1-(pyridine-2-carbonyl)piperidin-4-yl]furan-2-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)c2ccccn2)CC1)c1ccc(Br)o1 |
| InChI | InChI=1S/C16H16BrN3O3/c17-14-5-4-13(23-14)15(21)19-11-6-9-20(10-7-11)16(22)12-3-1-2-8-18-12/h1-5,8,11H,6-7,9-10H2,(H,19,21) |
| InChIKey | WABCCKLPUMSNRB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.23 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |