C20H22N4O3 — CID 108550474
N-[2-oxo-2-[[1-(pyridine-2-carbonyl)piperidin-4-yl]amino]ethyl]benzamide (PubChem CID 108550474) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is N-[2-oxo-2-[[1-(pyridine-2-carbonyl)piperidin-4-yl]amino]ethyl]benzamide.
| Compound Name | N-[2-oxo-2-[[1-(pyridine-2-carbonyl)piperidin-4-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 108550474 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | N-[2-oxo-2-[[1-(pyridine-2-carbonyl)piperidin-4-yl]amino]ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1)NC1CCN(C(=O)c2ccccn2)CC1 |
| InChI | InChI=1S/C20H22N4O3/c25-18(14-22-19(26)15-6-2-1-3-7-15)23-16-9-12-24(13-10-16)20(27)17-8-4-5-11-21-17/h1-8,11,16H,9-10,12-14H2,(H,22,26)(H,23,25) |
| InChIKey | ZYJRQHJFWJECJO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |