C23H27N3O5 — CID 108550402
N-[2-[[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]amino]-2-oxoethyl]benzamide (PubChem CID 108550402) has the molecular formula C23H27N3O5 and a molecular weight of 425.49 g/mol. Its IUPAC name is N-[2-[[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]amino]-2-oxoethyl]benzamide.
| Compound Name | N-[2-[[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 108550402 |
| Molecular Formula | C23H27N3O5 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | N-[2-[[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]amino]-2-oxoethyl]benzamide |
| SMILES | COc1cccc(OC)c1C(=O)N1CCC(NC(=O)CNC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H27N3O5/c1-30-18-9-6-10-19(31-2)21(18)23(29)26-13-11-17(12-14-26)25-20(27)15-24-22(28)16-7-4-3-5-8-16/h3-10,17H,11-15H2,1-2H3,(H,24,28)(H,25,27) |
| InChIKey | AZQZPLPRJXTJOI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |