C23H28N2O6 — CID 108549752
N-[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]-2,6-dimethoxybenzamide (PubChem CID 108549752) has the molecular formula C23H28N2O6 and a molecular weight of 428.49 g/mol. Its IUPAC name is N-[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]-2,6-dimethoxybenzamide.
| Compound Name | N-[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 108549752 |
| Molecular Formula | C23H28N2O6 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | N-[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)NC1CCN(C(=O)c2c(OC)cccc2OC)CC1 |
| InChI | InChI=1S/C23H28N2O6/c1-28-16-7-5-8-17(29-2)20(16)22(26)24-15-11-13-25(14-12-15)23(27)21-18(30-3)9-6-10-19(21)31-4/h5-10,15H,11-14H2,1-4H3,(H,24,26) |
| InChIKey | QRGDTVHEYGMVHG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |