C23H26N2O6 — CID 108548503
[3-[[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]carbamoyl]phenyl] acetate (PubChem CID 108548503) has the molecular formula C23H26N2O6 and a molecular weight of 426.47 g/mol. Its IUPAC name is [3-[[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]carbamoyl]phenyl] acetate.
| Compound Name | [3-[[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108548503 |
| Molecular Formula | C23H26N2O6 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | [3-[[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]carbamoyl]phenyl] acetate |
| SMILES | COc1cccc(OC)c1C(=O)N1CCC(NC(=O)c2cccc(OC(C)=O)c2)CC1 |
| InChI | InChI=1S/C23H26N2O6/c1-15(26)31-18-7-4-6-16(14-18)22(27)24-17-10-12-25(13-11-17)23(28)21-19(29-2)8-5-9-20(21)30-3/h4-9,14,17H,10-13H2,1-3H3,(H,24,27) |
| InChIKey | ILDUQFAVQONOBC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|