C21H19F3N2O4 — CID 108548568
[3-[[1-(2,3,4-trifluorobenzoyl)piperidin-4-yl]carbamoyl]phenyl] acetate (PubChem CID 108548568) has the molecular formula C21H19F3N2O4 and a molecular weight of 420.39 g/mol. Its IUPAC name is [3-[[1-(2,3,4-trifluorobenzoyl)piperidin-4-yl]carbamoyl]phenyl] acetate.
| Compound Name | [3-[[1-(2,3,4-trifluorobenzoyl)piperidin-4-yl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108548568 |
| Molecular Formula | C21H19F3N2O4 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | [3-[[1-(2,3,4-trifluorobenzoyl)piperidin-4-yl]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)NC2CCN(C(=O)c3ccc(F)c(F)c3F)CC2)c1 |
| InChI | InChI=1S/C21H19F3N2O4/c1-12(27)30-15-4-2-3-13(11-15)20(28)25-14-7-9-26(10-8-14)21(29)16-5-6-17(22)19(24)18(16)23/h2-6,11,14H,7-10H2,1H3,(H,25,28) |
| InChIKey | VNMBNJSNGSGSIW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|