C19H25ClN2O4 — CID 108559036
[3-[[1-(3-chloro-2,2-dimethylpropanoyl)piperidin-4-yl]carbamoyl]phenyl] acetate (PubChem CID 108559036) has the molecular formula C19H25ClN2O4 and a molecular weight of 380.87 g/mol. Its IUPAC name is [3-[[1-(3-chloro-2,2-dimethylpropanoyl)piperidin-4-yl]carbamoyl]phenyl] acetate.
| Compound Name | [3-[[1-(3-chloro-2,2-dimethylpropanoyl)piperidin-4-yl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108559036 |
| Molecular Formula | C19H25ClN2O4 |
| Molecular Weight | 380.87 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | [3-[[1-(3-chloro-2,2-dimethylpropanoyl)piperidin-4-yl]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)NC2CCN(C(=O)C(C)(C)CCl)CC2)c1 |
| InChI | InChI=1S/C19H25ClN2O4/c1-13(23)26-16-6-4-5-14(11-16)17(24)21-15-7-9-22(10-8-15)18(25)19(2,3)12-20/h4-6,11,15H,7-10,12H2,1-3H3,(H,21,24) |
| InChIKey | VDQBHOUODUXKKQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.87 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|