C20H21ClN2O5S — CID 108559052
[3-[[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]carbamoyl]phenyl] acetate (PubChem CID 108559052) has the molecular formula C20H21ClN2O5S and a molecular weight of 436.92 g/mol. Its IUPAC name is [3-[[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]carbamoyl]phenyl] acetate.
| Compound Name | [3-[[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108559052 |
| Molecular Formula | C20H21ClN2O5S |
| Molecular Weight | 436.92 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | [3-[[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)NC2CCN(S(=O)(=O)c3ccc(Cl)cc3)CC2)c1 |
| InChI | InChI=1S/C20H21ClN2O5S/c1-14(24)28-18-4-2-3-15(13-18)20(25)22-17-9-11-23(12-10-17)29(26,27)19-7-5-16(21)6-8-19/h2-8,13,17H,9-12H2,1H3,(H,22,25) |
| InChIKey | IOOJIKZNTWMIOI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.92 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|