C18H20N2O5S2 — CID 108559053
[3-[(1-thiophen-2-ylsulfonylpiperidin-4-yl)carbamoyl]phenyl] acetate (PubChem CID 108559053) has the molecular formula C18H20N2O5S2 and a molecular weight of 408.50 g/mol. Its IUPAC name is [3-[(1-thiophen-2-ylsulfonylpiperidin-4-yl)carbamoyl]phenyl] acetate.
| Compound Name | [3-[(1-thiophen-2-ylsulfonylpiperidin-4-yl)carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108559053 |
| Molecular Formula | C18H20N2O5S2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | [3-[(1-thiophen-2-ylsulfonylpiperidin-4-yl)carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)NC2CCN(S(=O)(=O)c3cccs3)CC2)c1 |
| InChI | InChI=1S/C18H20N2O5S2/c1-13(21)25-16-5-2-4-14(12-16)18(22)19-15-7-9-20(10-8-15)27(23,24)17-6-3-11-26-17/h2-6,11-12,15H,7-10H2,1H3,(H,19,22) |
| InChIKey | VQVBTNNYAWKRFY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|