C21H26N2O4 — CID 108927579
[3-[[1-[(E)-3-cyclopropylbut-2-enoyl]piperidin-4-yl]carbamoyl]phenyl] acetate (PubChem CID 108927579) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is [3-[[1-[(E)-3-cyclopropylbut-2-enoyl]piperidin-4-yl]carbamoyl]phenyl] acetate.
| Compound Name | [3-[[1-[(E)-3-cyclopropylbut-2-enoyl]piperidin-4-yl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108927579 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | [3-[[1-[(E)-3-cyclopropylbut-2-enoyl]piperidin-4-yl]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)NC2CCN(C(=O)/C=C(\C)C3CC3)CC2)c1 |
| InChI | InChI=1S/C21H26N2O4/c1-14(16-6-7-16)12-20(25)23-10-8-18(9-11-23)22-21(26)17-4-3-5-19(13-17)27-15(2)24/h3-5,12-13,16,18H,6-11H2,1-2H3,(H,22,26)/b14-12+ |
| InChIKey | JWVSWMNSYSAIFF-WYMLVPIESA-N |
| XLogP | 2.69 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|