C27H26N2O4 — CID 108549433
[3-[4-[(4-phenylbenzoyl)amino]piperidine-1-carbonyl]phenyl] acetate (PubChem CID 108549433) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is [3-[4-[(4-phenylbenzoyl)amino]piperidine-1-carbonyl]phenyl] acetate.
| Compound Name | [3-[4-[(4-phenylbenzoyl)amino]piperidine-1-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 108549433 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | [3-[4-[(4-phenylbenzoyl)amino]piperidine-1-carbonyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)N2CCC(NC(=O)c3ccc(-c4ccccc4)cc3)CC2)c1 |
| InChI | InChI=1S/C27H26N2O4/c1-19(30)33-25-9-5-8-23(18-25)27(32)29-16-14-24(15-17-29)28-26(31)22-12-10-21(11-13-22)20-6-3-2-4-7-20/h2-13,18,24H,14-17H2,1H3,(H,28,31) |
| InChIKey | VFOSISMTZMMXCU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|