C21H21IN2O4 — CID 108927398
[3-[4-[(2-iodobenzoyl)amino]piperidine-1-carbonyl]phenyl] acetate (PubChem CID 108927398) has the molecular formula C21H21IN2O4 and a molecular weight of 492.31 g/mol. Its IUPAC name is [3-[4-[(2-iodobenzoyl)amino]piperidine-1-carbonyl]phenyl] acetate.
| Compound Name | [3-[4-[(2-iodobenzoyl)amino]piperidine-1-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 108927398 |
| Molecular Formula | C21H21IN2O4 |
| Molecular Weight | 492.31 g/mol |
| Exact Mass | 492.05 |
| IUPAC Name | [3-[4-[(2-iodobenzoyl)amino]piperidine-1-carbonyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)N2CCC(NC(=O)c3ccccc3I)CC2)c1 |
| InChI | InChI=1S/C21H21IN2O4/c1-14(25)28-17-6-4-5-15(13-17)21(27)24-11-9-16(10-12-24)23-20(26)18-7-2-3-8-19(18)22/h2-8,13,16H,9-12H2,1H3,(H,23,26) |
| InChIKey | FWEGSANOYWUQFE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|