C16H18N2O4S2 — CID 108562969
3-hydroxy-N-(1-thiophen-2-ylsulfonylpiperidin-4-yl)benzamide (PubChem CID 108562969) has the molecular formula C16H18N2O4S2 and a molecular weight of 366.46 g/mol. Its IUPAC name is 3-hydroxy-N-(1-thiophen-2-ylsulfonylpiperidin-4-yl)benzamide.
| Compound Name | 3-hydroxy-N-(1-thiophen-2-ylsulfonylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 108562969 |
| Molecular Formula | C16H18N2O4S2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 3-hydroxy-N-(1-thiophen-2-ylsulfonylpiperidin-4-yl)benzamide |
| SMILES | O=C(NC1CCN(S(=O)(=O)c2cccs2)CC1)c1cccc(O)c1 |
| InChI | InChI=1S/C16H18N2O4S2/c19-14-4-1-3-12(11-14)16(20)17-13-6-8-18(9-7-13)24(21,22)15-5-2-10-23-15/h1-5,10-11,13,19H,6-9H2,(H,17,20) |
| InChIKey | SRVHBNGZNUHLMU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |