C15H18N2O3S2 — CID 141034176
2-[(1-thiophen-2-ylsulfonylpiperidin-4-yl)amino]phenol (PubChem CID 141034176) has the molecular formula C15H18N2O3S2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 2-[(1-thiophen-2-ylsulfonylpiperidin-4-yl)amino]phenol.
| Compound Name | 2-[(1-thiophen-2-ylsulfonylpiperidin-4-yl)amino]phenol |
|---|---|
| PubChem CID | 141034176 |
| Molecular Formula | C15H18N2O3S2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 2-[(1-thiophen-2-ylsulfonylpiperidin-4-yl)amino]phenol |
| SMILES | O=S(=O)(c1cccs1)N1CCC(Nc2ccccc2O)CC1 |
| InChI | InChI=1S/C15H18N2O3S2/c18-14-5-2-1-4-13(14)16-12-7-9-17(10-8-12)22(19,20)15-6-3-11-21-15/h1-6,11-12,16,18H,7-10H2 |
| InChIKey | DZNCLHZEZAASIL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|