C23H24N2O3S2 — CID 108559458
2,2-diphenyl-N-(1-thiophen-2-ylsulfonylpiperidin-4-yl)acetamide (PubChem CID 108559458) has the molecular formula C23H24N2O3S2 and a molecular weight of 440.59 g/mol. Its IUPAC name is 2,2-diphenyl-N-(1-thiophen-2-ylsulfonylpiperidin-4-yl)acetamide.
| Compound Name | 2,2-diphenyl-N-(1-thiophen-2-ylsulfonylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 108559458 |
| Molecular Formula | C23H24N2O3S2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 2,2-diphenyl-N-(1-thiophen-2-ylsulfonylpiperidin-4-yl)acetamide |
| SMILES | O=C(NC1CCN(S(=O)(=O)c2cccs2)CC1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H24N2O3S2/c26-23(22(18-8-3-1-4-9-18)19-10-5-2-6-11-19)24-20-13-15-25(16-14-20)30(27,28)21-12-7-17-29-21/h1-12,17,20,22H,13-16H2,(H,24,26) |
| InChIKey | RXLIBEWKYFYPOM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |