C23H31N3O3S2 — CID 53031675
N-(1-benzylpiperidin-4-yl)-2-(1-thiophen-2-ylsulfonylpiperidin-4-yl)acetamide (PubChem CID 53031675) has the molecular formula C23H31N3O3S2 and a molecular weight of 461.65 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-2-(1-thiophen-2-ylsulfonylpiperidin-4-yl)acetamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-2-(1-thiophen-2-ylsulfonylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 53031675 |
| Molecular Formula | C23H31N3O3S2 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-2-(1-thiophen-2-ylsulfonylpiperidin-4-yl)acetamide |
| SMILES | O=C(CC1CCN(S(=O)(=O)c2cccs2)CC1)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H31N3O3S2/c27-22(24-21-10-12-25(13-11-21)18-20-5-2-1-3-6-20)17-19-8-14-26(15-9-19)31(28,29)23-7-4-16-30-23/h1-7,16,19,21H,8-15,17-18H2,(H,24,27) |
| InChIKey | YIFCTGSYYFVKCC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |