C17H18Cl2N2O4S2 — CID 108561076
2-(2,4-dichlorophenoxy)-N-(1-thiophen-2-ylsulfonylpiperidin-4-yl)acetamide (PubChem CID 108561076) has the molecular formula C17H18Cl2N2O4S2 and a molecular weight of 449.38 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-(1-thiophen-2-ylsulfonylpiperidin-4-yl)acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-(1-thiophen-2-ylsulfonylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 108561076 |
| Molecular Formula | C17H18Cl2N2O4S2 |
| Molecular Weight | 449.38 g/mol |
| Exact Mass | 448.01 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-(1-thiophen-2-ylsulfonylpiperidin-4-yl)acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)NC1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C17H18Cl2N2O4S2/c18-12-3-4-15(14(19)10-12)25-11-16(22)20-13-5-7-21(8-6-13)27(23,24)17-2-1-9-26-17/h1-4,9-10,13H,5-8,11H2,(H,20,22) |
| InChIKey | NFWXFZXLMDRHFQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |