C14H18Cl2N2O4S — CID 47910189
2-(2,4-dichlorophenoxy)-N-(1-methylsulfonylpiperidin-3-yl)acetamide (PubChem CID 47910189) has the molecular formula C14H18Cl2N2O4S and a molecular weight of 381.28 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-(1-methylsulfonylpiperidin-3-yl)acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-(1-methylsulfonylpiperidin-3-yl)acetamide |
|---|---|
| PubChem CID | 47910189 |
| Molecular Formula | C14H18Cl2N2O4S |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-(1-methylsulfonylpiperidin-3-yl)acetamide |
| SMILES | CS(=O)(=O)N1CCCC(NC(=O)COc2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C14H18Cl2N2O4S/c1-23(20,21)18-6-2-3-11(8-18)17-14(19)9-22-13-5-4-10(15)7-12(13)16/h4-5,7,11H,2-3,6,8-9H2,1H3,(H,17,19) |
| InChIKey | WSRRLBZPVJUJCJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |