C15H19F3N2O4S — CID 47910347
N-(1-methylsulfonylpiperidin-3-yl)-2-[4-(trifluoromethyl)phenoxy]acetamide (PubChem CID 47910347) has the molecular formula C15H19F3N2O4S and a molecular weight of 380.39 g/mol. Its IUPAC name is N-(1-methylsulfonylpiperidin-3-yl)-2-[4-(trifluoromethyl)phenoxy]acetamide.
| Compound Name | N-(1-methylsulfonylpiperidin-3-yl)-2-[4-(trifluoromethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 47910347 |
| Molecular Formula | C15H19F3N2O4S |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | N-(1-methylsulfonylpiperidin-3-yl)-2-[4-(trifluoromethyl)phenoxy]acetamide |
| SMILES | CS(=O)(=O)N1CCCC(NC(=O)COc2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C15H19F3N2O4S/c1-25(22,23)20-8-2-3-12(9-20)19-14(21)10-24-13-6-4-11(5-7-13)15(16,17)18/h4-7,12H,2-3,8-10H2,1H3,(H,19,21) |
| InChIKey | OPZBXNJCOKLJQE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |